CAS 22647-95-6

5-(4-Bromophenyl)pentanoic acid

Description:

5-(4-Bromophenyl)pentanoic acid is an organic compound characterized by its structure, which includes a pentanoic acid chain with a bromophenyl substituent at the fifth carbon. This compound features a carboxylic acid functional group (-COOH), which imparts acidic properties and allows for hydrogen bonding, influencing its solubility in polar solvents. The presence of the bromine atom on the phenyl ring enhances the compound's reactivity and can affect its biological activity, making it of interest in medicinal chemistry. The molecular structure contributes to its potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or analgesic agents. Additionally, the compound's physical properties, such as melting point and boiling point, are influenced by the molecular weight and the presence of the bromine substituent. Overall, 5-(4-Bromophenyl)pentanoic acid is a compound of interest due to its unique structural features and potential applications in various chemical and biological contexts.

Formula: C₁₁H₁₃BrO₂

InChI: InChI=1/C11H13BrO2/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h5-8H,1-4H2,(H,13,14)

SMILES: C(CCC(=O)O)Cc1ccc(cc1)Br

Synonyms:

• Benzenepentanoic acid, 4-bromo-
• 4-Bromo-benzenepentanoic acid
• 5-(4-bromophenyl)pentanoic acid

5-(4-Bromophenyl)pentanoic acid

CAS: 22647-95-6

Formula: C₁₁H₁₃BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 257.1237

Ref: IN-DA00BGNS

5-(4-Bromophenyl)pentanoic acid

CAS: 22647-95-6

5-(4-Bromophenyl)pentanoic acid

Purity: 95%

Molecular weight: 257.12g/mol

Ref: 54-OR82972

5-(4-Bromophenyl)pentanoic acid

CAS: 22647-95-6

Purity: 95%

Molecular weight: 257.1270142

Ref: 10-F640398

5-(4-bromophenyl)pentanoic acid

CAS: 22647-95-6

5-(4-Bromophenyl)pentanoic acid is a molecule that is synthetically derived from the natural product pentalenene. It can be used to debrominate ccr5 in vitro, and has been envisaged as a synthetic chemotherapeutic agent for HIV infection. 5-(4-Bromophenyl)pentanoic acid is an amide of pentanoic acid and dibenzoylmethane. It is a biomolecular agent that has been shown to induce chromosomal rearrangements and chemokine modifications in cancer cells. 5-(4-Bromophenyl)pentanoic acid also prevents apoptosis by binding to survivin, thereby inhibiting its ability to trigger apoptosis.

Formula: C₁₁H₁₃BrO₂

Purity: Min. 95%

Molecular weight: 257.1 g/mol

Ref: 3D-XAA64795