CAS 22649-28-1

2H-chromene-3-carboxylic acid

Description:

2H-Chromene-3-carboxylic acid, also known as coumarin-3-carboxylic acid, is an organic compound characterized by its chromene structure, which consists of a benzene ring fused to a pyran ring. This compound features a carboxylic acid functional group (-COOH) at the 3-position of the chromene ring, contributing to its acidic properties. It is typically a white to off-white crystalline solid that is soluble in polar solvents like water and alcohols, while being less soluble in non-polar solvents. The presence of the carboxylic acid group allows for hydrogen bonding, enhancing its solubility and reactivity. 2H-Chromene-3-carboxylic acid is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities, such as anti-inflammatory and antioxidant properties. Additionally, it can serve as a precursor for the synthesis of other chemical compounds, making it valuable in organic synthesis. Its stability and reactivity can be influenced by environmental factors such as pH and temperature.

Formula: C₁₀H₈subO₃

InChI: InChI=1/C10H8O3/c11-10(12)8-5-7-3-1-2-4-9(7)13-6-8/h1-5H,6H2,(H,11,12)/p-1

SMILES: c1ccc2c(c1)C=C(CO2)C(=O)[O-]

Synonyms:

• 2H-1-Benzopyran-3-carboxylicacid
• 2H-chromene-3-carboxylate

2H-Chromene-3-carboxylic acid

CAS: 22649-28-1

Formula: C₁₀H₈O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 176.1687

Ref: IN-DA00BDLI

2H-1-Benzopyran-3-carboxylic acid

CAS: 22649-28-1

2H-1-Benzopyran-3-carboxylic acid

Formula: C₁₀H₈O₃

Purity: ≥95%

Color and Shape: light orange to light brown solid

Molecular weight: 176.17g/mol

Ref: 54-OR23377

2H-Chromene-3-carboxylic acid

CAS: 22649-28-1

Formula: C₁₀H₈O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 176.171

Ref: 10-F020713