CAS 2265-93-2
:2,4-Difluoro-1-iodobenzene
Description:
2,4-Difluoro-1-iodobenzene is an aromatic halogenated compound characterized by the presence of two fluorine atoms and one iodine atom attached to a benzene ring. Its molecular formula is C6H3F2I, indicating that it contains six carbon atoms, three hydrogen atoms, two fluorine atoms, and one iodine atom. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature. It has a relatively low boiling point and is soluble in organic solvents, making it useful in various chemical reactions and applications. The presence of both fluorine and iodine atoms contributes to its reactivity, particularly in nucleophilic substitution reactions. Additionally, 2,4-difluoro-1-iodobenzene can serve as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Safety precautions should be taken when handling this substance, as halogenated compounds can pose health risks and environmental concerns.
Formula:C6H3F2I
InChI:InChI=1/C6H3F2I/c7-4-1-2-6(9)5(8)3-4/h1-3H
SMILES:c1cc(c(cc1F)F)I
Synonyms:- 2,4-Difluoroiodobenzene
- 1,3-Difluoro-4-iodobenzene
- 2,4-Difluoro-1-iodobenze
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4-Difluoro-1-iodobenzene, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H3F2IPurity:99%Color and Shape:Clear colorless to yellow or pale pink, LiquidMolecular weight:239.992,4-difluoro-1-iodobenzene
CAS:Formula:C6H3F2IPurity:98%Color and Shape:LiquidMolecular weight:239.98932,4-Difluoroiodobenzene
CAS:2,4-DifluoroiodobenzeneFormula:C6H3F2IPurity:98%Color and Shape: clear. colourless liquidMolecular weight:239.99g/mol



