CAS 22659-83-2
:3-(2,3,5,6-Tetramethylbenzoyl)acrylic acid
Description:
3-(2,3,5,6-Tetramethylbenzoyl)acrylic acid, with the CAS number 22659-83-2, is an organic compound characterized by its unique structure that includes both an acrylic acid moiety and a tetramethylbenzoyl group. This compound typically appears as a solid or viscous liquid, depending on its purity and specific conditions. It is known for its potential applications in photoinitiators for polymerization processes, particularly in UV-curable coatings and inks. The presence of the tetramethylbenzoyl group enhances its light absorption properties, making it effective in initiating polymerization upon exposure to UV light. Additionally, the acrylic acid component contributes to its reactivity, allowing it to participate in various chemical reactions, including esterification and copolymerization. The compound is generally stable under normal conditions but may undergo degradation when exposed to extreme temperatures or prolonged UV radiation. Safety precautions should be taken when handling this substance, as it may cause irritation to the skin and eyes.
Formula:C14H16O3
InChI:InChI=1/C14H16O3/c1-8-7-9(2)11(4)14(10(8)3)12(15)5-6-13(16)17/h5-7H,1-4H3,(H,16,17)/b6-5+
Synonyms:- (2E)-4-oxo-4-(2,3,5,6-tetramethylphenyl)but-2-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-(2,3,5,6-Tetramethylbenzoyl)-acrylic acid
CAS:3-(2,3,5,6-Tetramethylbenzoyl)-acrylic acid is a versatile building block for the synthesis of complex compounds. It is used as a reagent to make other chemicals and has been used in the synthesis of research chemicals. 3-(2,3,5,6-Tetramethylbenzoyl)-acrylic acid is also useful as an intermediate or scaffold compound in organic chemistry. This product has high purity and quality.Formula:C14H16O3Purity:Min. 95%Molecular weight:232.28 g/mol
