CAS 2266-48-0
:Ethyl 2,2-difluoroacetoacetate
Description:
Ethyl 2,2-difluoroacetoacetate is an organic compound characterized by its structure, which includes an ethyl ester group and two fluorine atoms attached to the second carbon of the acetoacetate moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive fruity odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic ethyl group. Ethyl 2,2-difluoroacetoacetate is often utilized in synthetic organic chemistry, particularly in the preparation of fluorinated compounds and as an intermediate in various chemical reactions, including Michael additions and condensation reactions. The presence of fluorine atoms enhances its reactivity and can influence the physical properties, such as boiling point and polarity. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested. Proper storage in a cool, dry place away from incompatible materials is also recommended to maintain its stability.
Formula:C6H8F2O3
InChI:InChI=1/C6H8F2O3/c1-3-11-5(10)6(7,8)4(2)9/h3H2,1-2H3
SMILES:CCOC(=O)C(C(=O)C)(F)F
Synonyms:- 2,2-Difluoroacetoacetic acid ethyl ester
- Ethyl 2,2-Difluoro-3-Oxobutanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ethyl 2,2-difluoroacetoacetate
CAS:Ethyl 2,2-difluoroacetoacetatePurity:95%Molecular weight:166.12g/mol2,2-Difluoro-3-oxobutyric acid ethyl ester
CAS:2,2-Difluoro-3-oxobutyric acid ethyl ester is an alcohol that is synthesized through a chemoenzymatic process. It is used as a substrate in the reaction with sodium formate and formate dehydrogenase. This synthetic method was developed by E.J. Corey in 1972 and has been used to synthesize optically pure (R)-2,2-difluoro-3-oxobutyric acid ethyl ester. The synthesis of (S)-2,2-difluoro-3-oxobutyric acid ethyl ester can be achieved by using glucose dehydrogenase instead of formate dehydrogenase.Formula:C6H8F2O3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:166.12 g/mol


