
CAS 226715-59-9
:(2R,3S,8S,14R,15R)-3,4-Dihydro-2,8-bis(4-hydroxyphenyl)-8,14-methano-2H,14H-1-benzopyrano[7,8-d][1,3]benzodioxocin-3,5,11,13,15-pentol
Description:
The chemical substance with the name "(2R,3S,8S,14R,15R)-3,4-Dihydro-2,8-bis(4-hydroxyphenyl)-8,14-methano-2H,14H-1-benzopyrano[7,8-d][1,3]benzodioxocin-3,5,11,13,15-pentol" and CAS number "226715-59-9" is a complex organic compound characterized by its intricate polycyclic structure and multiple hydroxyl groups. This compound features a benzopyrano-dioxocin framework, which contributes to its potential biological activity. The presence of multiple hydroxyl groups suggests that it may exhibit strong hydrogen bonding capabilities, influencing its solubility and reactivity. Additionally, the stereochemistry indicated by the R and S designations suggests that the compound may have specific spatial arrangements that could affect its interaction with biological targets. Such compounds are often studied for their potential pharmacological properties, including antioxidant and anti-inflammatory activities. Overall, the unique structural features of this substance make it a subject of interest in medicinal chemistry and natural product research.
Formula:C30H24O10
InChI:InChI=1S/C30H24O10/c31-15-5-1-13(2-6-15)27-21(36)11-18-19(34)12-23-25(28(18)38-27)26-24-20(35)9-17(33)10-22(24)39-30(40-23,29(26)37)14-3-7-16(32)8-4-14/h1-10,12,21,26-27,29,31-37H,11H2/t21-,26+,27+,29+,30-/m0/s1
InChI key:InChIKey=LQRHGTVFFPMWCG-TXZJYACMSA-N
SMILES:O[C@H]1[C@@]2(OC3=C([C@]1(C=4C(O2)=CC(O)=CC4O)[H])C5=C(C(O)=C3)C[C@H](O)[C@H](O5)C6=CC=C(O)C=C6)C7=CC=C(O)C=C7
Synonyms:- 8,14-Methano-2H,14H-1-benzopyrano[7,8-d][1,3]benzodioxocin-3,5,11,13,15-pentol, 3,4-dihydro-2,8-bis(4-hydroxyphenyl)-, (2R,3S,8S,14R,15R)-
- Geranin A
- (+)-Geranin A
- (2R,3S,8S,14R,15R)-3,4-Dihydro-2,8-bis(4-hydroxyphenyl)-8,14-methano-2H,14H-1-benzopyrano[7,8-d][1,3]benzodioxocin-3,5,11,13,15-pentol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Geranin A
CAS:Geranin A, an A-type proanthocyanidin, can be isolated from the antiprotozoal extract of Geranium niveum [1].Formula:C30H24O10Color and Shape:SolidMolecular weight:544.51
