CAS 22677-62-9

Valyllysine

Description:

Valyllysine, with the CAS number 22677-62-9, is a dipeptide composed of the amino acids valine and lysine. It is characterized by its specific sequence, where valine is linked to lysine through a peptide bond. This compound is typically found in protein structures and plays a role in various biological processes. Valyllysine exhibits properties common to peptides, such as solubility in water and the ability to form hydrogen bonds, which contribute to its stability and functionality in biological systems. The presence of the lysine residue imparts a positive charge at physiological pH, influencing its interactions with other biomolecules. Additionally, valyllysine can be involved in metabolic pathways and may have implications in nutrition and health, particularly in protein synthesis and cellular functions. Its unique combination of amino acids allows it to participate in various biochemical reactions, making it a subject of interest in both research and potential therapeutic applications.

Formula: C₁₁H₂₃N₃O₃

InChI: InChI=1S/C11H23N3O3/c1-7(2)9(13)10(15)14-8(11(16)17)5-3-4-6-12/h7-9H,3-6,12-13H2,1-2H3,(H,14,15)(H,16,17)/t8-,9-/m0/s1

InChI key: InChIKey=JKHXYJKMNSSFFL-IUCAKERBSA-N

SMILES: [C@H](NC([C@H](C(C)C)N)=O)(CCCCN)C(O)=O

Synonyms:

• L-Lysine, N2-L-valyl-
• L-Valyl-L-lysine
• Valyllysine
• Lysine, N2-L-valyl-, L-
• L-Lysine, L-valyl-

H-Val-Lys-OH

CAS: 22677-62-9

Bachem ID: 4017637.

Formula: C₁₁H₂₃N₃O₃

Purity: > 99%

Color and Shape: White Powder

Molecular weight: 245.32

Ref: 01-4017637

Valyllysine

CAS: 22677-62-9

Valyllysine is a dipeptide composed of valine and lysine. It is an incomplete breakdown product of protein digestion or protein catabolism.

Formula: C₁₁H₂₃N₃O₃

Color and Shape: Solid

Molecular weight: 245.32

Ref: TM-T35032