CAS 22688-78-4: Kaempferol 3-O-glucuronide
Description:Kaempferol 3-O-glucuronide is a flavonoid glycoside, a derivative of kaempferol, which is a naturally occurring flavonoid found in various plants. This compound is characterized by the presence of a glucuronic acid moiety attached to the 3-position of the kaempferol structure, enhancing its solubility and bioavailability. It exhibits antioxidant properties, contributing to its potential health benefits, including anti-inflammatory and anticancer activities. Kaempferol 3-O-glucuronide is often studied for its role in plant defense mechanisms and its effects on human health, particularly in relation to chronic diseases. It is soluble in water and polar solvents, making it readily absorbable in biological systems. The compound is typically found in various fruits, vegetables, and herbs, and its presence can be indicative of the nutritional value of these foods. As a subject of research, kaempferol 3-O-glucuronide is of interest in pharmacology and nutrition, with ongoing studies exploring its therapeutic potential and mechanisms of action in the human body.
Formula:C21H18O12
InChI:InChI=1S/C21H18O12/c22-8-3-1-7(2-4-8)17-18(13(25)12-10(24)5-9(23)6-11(12)31-17)32-21-16(28)14(26)15(27)19(33-21)20(29)30/h1-6,14-16,19,21-24,26-28H,(H,29,30)/t14-,15-,16+,19-,21+/m0/s1
InChI key:InChIKey=FNTJVYCFNVUBOL-ZUGPOPFOSA-N
SMILES:O=C(O)C1OC(OC=2C(=O)C=3C(O)=CC(O)=CC3OC2C=4C=CC(O)=CC4)C(O)C(O)C1O
- Synonyms:
- Glucuronyl-3-kaempferol
- β-D-Glucopyranosiduronic acid, 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-3-yl
- Glucopyranosiduronic acid, 5,7-dihydroxy-2-(p-hydroxyphenyl)-4-oxo-4H-1-benzopyran-3-yl, β-D-
- Kaempferol 3-glucuronide
- 5,7-Dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-3-yl β-D-glucopyranosiduronic acid
