CAS 226881-07-8
:1-(4-Bromophenyl)-2-oxo-3-pyrrolidinecarboxylic acid
Description:
1-(4-Bromophenyl)-2-oxo-3-pyrrolidinecarboxylic acid, identified by its CAS number 226881-07-8, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a bromophenyl group. This compound features a carboxylic acid functional group and a ketone, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The pyrrolidine ring adds to its cyclic nature, influencing its conformational stability and interactions with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. Its solubility, stability, and reactivity can vary depending on the solvent and conditions, which are important considerations for its practical applications in research and industry. Overall, 1-(4-Bromophenyl)-2-oxo-3-pyrrolidinecarboxylic acid is a versatile compound with potential implications in both synthetic and medicinal chemistry.
Formula:C11H10BrNO3
InChI:InChI=1S/C11H10BrNO3/c12-7-1-3-8(4-2-7)13-6-5-9(10(13)14)11(15)16/h1-4,9H,5-6H2,(H,15,16)
InChI key:InChIKey=PHJMARYQKJGPKG-UHFFFAOYSA-N
SMILES:O=C1N(CCC1C(O)=O)C2=CC=C(Br)C=C2
Synonyms:- 3-Pyrrolidinecarboxylic acid, 1-(4-bromophenyl)-2-oxo-
- 1-(4-Bromophenyl)-2-oxo-3-pyrrolidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
