CAS 226916-19-4

(2E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoic acid

Description:

(2E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoic acid, with CAS number 226916-19-4, is a chemical compound characterized by its unique spirocyclic structure, which includes a dioxaspiro moiety. This compound features a prop-2-enoic acid functional group, indicating the presence of both an alkene and a carboxylic acid. The spiro structure contributes to its rigidity and may influence its reactivity and interaction with biological systems. The presence of the dioxaspiro unit suggests potential applications in medicinal chemistry, particularly in the development of novel pharmaceuticals, due to its ability to mimic complex natural products. Additionally, the compound's geometric configuration (2E) indicates the specific arrangement of substituents around the double bond, which can affect its physical properties and biological activity. Overall, this compound exemplifies the intricate relationship between molecular structure and function, making it a subject of interest in various fields, including organic synthesis and drug design.

Formula: C₁₁H₁₄O₄

InChI: InChI=1/C11H14O4/c12-10(13)4-3-9-2-1-5-11(8-9)14-6-7-15-11/h2-4H,1,5-8H2,(H,12,13)/b4-3+

Synonyms:

• (2E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid
• 3-(1,4-Dioxaspiro[4.5]Dec-7-En-7-Yl)Prop-2-Enoic Acid
• 3-(1,4-Dioxaspiro[4.5]Dec-7-En-7-Yl)Acrylic Acid
• (E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid

(E)-3-(1,4-DIOXASPIRO[4.5]DEC-7-EN-7-YL)ACRYLIC ACID

CAS: 226916-19-4

Formula: C₁₁H₁₄O₄

Purity: 95%

Molecular weight: 210.2265

Ref: IN-DA006X0U

(2E)-3-{1,4-Dioxaspiro[4.5]dec-7-en-7-yl}prop-2-enoic acid

CAS: 226916-19-4

(2E)-3-{1,4-Dioxaspiro[4.5]dec-7-en-7-yl}prop-2-enoic acid

Purity: ≥95%

Molecular weight: 210.23g/mol

Ref: 54-OR303181

(E)-3-(1,4-Dioxaspiro[4.5]dec-7-en-7-yl)acrylic acid

CAS: 226916-19-4

Formula: C₁₁H₁₄O₄

Purity: 95.0%

Molecular weight: 210.229

Ref: 10-F221825