CAS 226942-29-6

6-bromo-1,2,3,4-tetrahydroisoquinoline

Description:

6-Bromo-1,2,3,4-tetrahydroisoquinoline is a bicyclic organic compound characterized by its tetrahydroisoquinoline structure, which consists of a fused benzene and piperidine ring. The presence of a bromine atom at the 6-position introduces notable reactivity and influences its chemical properties, such as polarity and solubility. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is of interest in medicinal chemistry due to its potential biological activities, including effects on the central nervous system and possible applications in drug development. The compound's molecular structure allows for various functional group modifications, making it a versatile intermediate in organic synthesis. Additionally, its relatively low molecular weight and the presence of nitrogen in the ring contribute to its basicity and potential interactions with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose specific health risks. Overall, 6-bromo-1,2,3,4-tetrahydroisoquinoline represents a significant compound in the study of pharmacologically active substances.

Formula: C₉H₁₀BrN

InChI: InChI=1/C9H10BrN/c10-9-2-1-8-6-11-4-3-7(8)5-9/h1-2,5,11H,3-4,6H2

SMILES: c1cc(cc2CCNCc12)Br

Synonyms:

• Isoquinoline, 6-Bromo-1,2,3,4-Tetrahydro-
• 6-Bromo-1,2,3,4-tetra hydro isoquinoline:

6-Bromo-1,2,3,4-tetrahydroisoquinoline

CAS: 226942-29-6

Formula: C₉H₁₀BrN

Purity: 95%

Color and Shape: Solid

Molecular weight: 212.0864

Ref: IN-DA003N3G

6-Bromo-1,2,3,4-tetrahydroisoquinoline

CAS: 226942-29-6

6-Bromo-1,2,3,4-tetrahydroisoquinoline

Purity: 99%

Molecular weight: 212.09g/mol

Ref: 54-OR95845

6-Bromo-1,2,3,4-tetrahydroisoquinoline

CAS: 226942-29-6

Formula: C₉H₁₀BrN

Purity: 95%

Color and Shape: Solid

Molecular weight: 212.09

Ref: 10-F076472