CAS 2270-20-4: Benzenepentanoic acid
Description:Benzenepentanoic acid, also known as 3-phenylpentanoic acid, is an aromatic carboxylic acid characterized by a pentanoic acid chain attached to a phenyl group. Its molecular structure features a five-carbon straight chain (pentanoic acid) with a phenyl substituent at the third carbon position. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, but its solubility in water is limited due to the hydrophobic nature of the phenyl group. Benzenepentanoic acid exhibits typical carboxylic acid properties, including the ability to form hydrogen bonds, which contributes to its reactivity and potential applications in organic synthesis. It can participate in various chemical reactions, such as esterification and amidation, making it useful in the production of esters and other derivatives. Additionally, its structure allows for potential applications in pharmaceuticals, agrochemicals, and as a building block in organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C11H14O2
InChI:InChI=1S/C11H14O2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,12,13)
InChI key:InChIKey=BYHDDXPKOZIZRV-UHFFFAOYSA-N
SMILES:O=C(O)CCCCC=1C=CC=CC1
- Synonyms:
- 5-Phenylpentanoate
- 5-Phenylpentanoic acid
- Benzenepentanoic acid
- NSC 65637
- Phenylpentanoic acid
- Phenylvaleric acid
- Valeric acid, 5-phenyl-
- Valeric acid, δ-phenyl-
- δ-Phenylvaleric acid
- 5-Phenylvaleric acid
- See more synonyms
