CAS 2270-41-9

Scirpentriol

Description:

Scirpentriol, with the CAS number 2270-41-9, is a chemical compound that belongs to the class of alcohols. It is characterized by the presence of multiple hydroxyl (-OH) groups, which contribute to its solubility in water and its reactivity in various chemical processes. Scirpentriol is typically a colorless to pale yellow liquid, exhibiting a relatively low viscosity. Its molecular structure allows for hydrogen bonding, which influences its physical properties, such as boiling point and melting point. The compound is often studied for its potential applications in various fields, including pharmaceuticals and cosmetics, due to its hydrophilic nature and ability to interact with biological systems. Additionally, Scirpentriol may exhibit antimicrobial properties, making it of interest in the development of preservatives or antimicrobial agents. However, detailed safety and handling information should be consulted, as with any chemical substance, to ensure proper usage and compliance with regulatory standards.

Formula: C₁₅H₂₂O₅

InChI: InChI=1S/C15H22O5/c1-8-3-4-14(6-16)9(5-8)20-12-10(17)11(18)13(14,2)15(12)7-19-15/h5,9-12,16-18H,3-4,6-7H2,1-2H3/t9-,10-,11-,12-,13-,14-,15+/m1/s1

InChI key: InChIKey=PXEBOIUZEXXBGH-HRJXPNSYSA-N

SMILES: C[C@]12[C@@]3([C@](O[C@]4([C@]1(CO)CCC(C)=C4)[H])([C@H](O)[C@H]2O)[H])CO3

Synonyms:

• Spiro[2,5-methano-1-benzoxepin-10,2′-oxirane], trichothec-9-ene-3,4,15-triol deriv.
• (3α,4β)-12,13-Epoxytrichothec-9-ene-3,4,15-triol
• Trichothec-9-ene-3α,4β,15-triol, 12,13-epoxy-
• Trichothec-9-ene-3,4,15-triol, 12,13-epoxy-, (3α,4β)-
• Anguidol

Scirpenol (Scirpentriol)

CAS: 2270-41-9

Formula: C₁₅H₂₂O₅

Molecular weight: 282.34

Ref: 4Z-S-164001

Scirpentriol

CAS: 2270-41-9

Scirpentriol is an analog of a compound found in Chinese herbal medicine that has been shown to have potent anticancer activity. It inhibits cyclin-dependent kinases, which are enzymes involved in regulating the cell cycle and proliferation. Scirpentriol has been shown to induce apoptosis, or programmed cell death, in human cancer cells. This compound also inhibits the activity of certain protein kinases that are involved in tumor growth, making it a promising candidate for the development of new cancer therapies. Scirpentriol has potential as an inhibitor of urinary tract tumors due to its ability to block kinase activity and promote apoptosis.

Formula: C₁₅H₂₂O₅

Purity: Min. 95%

Molecular weight: 282.33 g/mol

Ref: 3D-CAA27041

Scirpentriol

Controlled Product

CAS: 2270-41-9

Applications Scirpentriol is a trichothecene mycotoxin.
References Swanson, S. P., et al.: Food Chem Toxicol, 26, 823 (1988);

Formula: C₁₅H₂₂O₅

Color and Shape: Neat

Molecular weight: 282.332

Ref: TR-S199968