CAS 227017-97-2

N-3-Pyridinyl-2-pyridinemethanamine

Description:

N-3-Pyridinyl-2-pyridinemethanamine, with the CAS number 227017-97-2, is a chemical compound characterized by its dual pyridine rings, which contribute to its aromatic properties and potential biological activity. This compound features an amine functional group, which can participate in hydrogen bonding and influence its solubility and reactivity. The presence of the pyridinyl groups suggests that it may exhibit basic properties, making it a potential ligand in coordination chemistry or a candidate for pharmaceutical applications. Its structural configuration allows for various interactions with biological targets, which may be of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and the presence of other functional groups in a given environment. Overall, N-3-Pyridinyl-2-pyridinemethanamine represents a class of compounds that may have significant implications in drug design and development, particularly in the context of targeting specific biological pathways.

Formula: C₁₁H₁₁N₃

InChI: InChI=1S/C11H11N3/c1-2-7-13-11(4-1)9-14-10-5-3-6-12-8-10/h1-8,14H,9H2

InChI key: InChIKey=OELQXGHMMBRMDL-UHFFFAOYSA-N

SMILES: C(NC=1C=CC=NC1)C2=CC=CC=N2

Synonyms:

• N-3-Pyridinyl-2-pyridinemethanamine
• 2-Pyridinemethanamine, N-3-pyridinyl-

N-[(Pyridin-2-yl)methyl]pyridin-3-amine

CAS: 227017-97-2

N-[(Pyridin-2-yl)methyl]pyridin-3-amine (NMP) is a nitrate salt that belongs to the class of anions. It forms complexes with metal cations and has been shown to be an effective ligand for lanthanide ions. NMP has also been shown to have luminescent properties, which are mediated by its ability to bind to metal cations. The crystal structure of NMP in the solid state was determined by single crystal x-ray diffraction. The molecule adopts a polyhedral geometry with two unsymmetrical geometries; one is a square pyramid and the other is a distorted octahedron. These two structures are related through a symmetry operation called glide reflection, which transforms one structure into the other. This transformation can be used to generate infinite architectural variations.

Formula: C₁₁H₁₁N₃

Purity: Min. 95%

Molecular weight: 185.22 g/mol

Ref: 3D-CJA01797