CAS 22704-59-2

N-(2,4-dichlorobenzyl)butan-1-amine

Description:

N-(2,4-dichlorobenzyl)butan-1-amine, with the CAS number 22704-59-2, is an organic compound characterized by its amine functional group and a butyl chain. This substance features a dichlorobenzyl moiety, which contributes to its chemical properties and potential biological activity. The presence of chlorine atoms on the benzene ring enhances its lipophilicity and may influence its interaction with biological systems. Typically, compounds like this can exhibit various pharmacological effects, making them of interest in medicinal chemistry. The amine group can participate in hydrogen bonding, affecting solubility and reactivity. Additionally, the structural configuration suggests potential applications in the synthesis of more complex molecules or as intermediates in organic synthesis. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or environmental impact. Overall, N-(2,4-dichlorobenzyl)butan-1-amine represents a class of compounds that may have significant implications in research and industry, particularly in the fields of pharmaceuticals and agrochemicals.

Formula: C₁₁H₁₅Cl₂N

InChI: InChI=1/C11H15Cl2N/c1-2-3-6-14-8-9-4-5-10(12)7-11(9)13/h4-5,7,14H,2-3,6,8H2,1H3

SMILES: CCCCNCc1ccc(cc1Cl)Cl

Synonyms:

• Benzenemethanamine, N-butyl-2,4-dichloro-

butyl[(2,4-dichlorophenyl)methyl]amine

CAS: 22704-59-2

Formula: C₁₁H₁₅Cl₂N

Purity: 95.0%

Molecular weight: 232.15

Ref: 10-F523128