CAS 22710-07-2
:2,3-Dimethylpyridine-N-oxide
Description:
2,3-Dimethylpyridine-N-oxide is a heterocyclic organic compound characterized by a pyridine ring with two methyl groups at the 2 and 3 positions and an N-oxide functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in polar solvents like water and alcohols, which enhances its utility in various chemical reactions and applications. The presence of the N-oxide group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the formation of other nitrogen-containing compounds. Additionally, 2,3-Dimethylpyridine-N-oxide exhibits basic properties due to the nitrogen atom in the pyridine ring, allowing it to participate in acid-base reactions. Its unique structure and properties make it relevant in fields such as pharmaceuticals, agrochemicals, and materials science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H9NO
InChI:InChI=1/C7H9NO/c1-6-4-3-5-8(9)7(6)2/h3-5H,1-2H3
InChI key:InChIKey=QWLULCKKOHDCIE-UHFFFAOYSA-N
SMILES:Cc1cccn(=O)c1C
Synonyms:- 2,3-Dimethyl-1-oxidopyridin-1-ium
- 2,3-Dimethylpyridine 1-Oxide
- 2,3-Lutidine, 1-oxide
- 2,3-Lutidine-N-Oxide
- Pyridine, 2,3-dimethyl-, 1-oxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2,3-Dimethylpyridine-N-Oxide
CAS:Formula:C7H9NOPurity:95%Color and Shape:SolidMolecular weight:123.15252,3-Lutidine-N-oxide
CAS:Controlled Product<p>Applications 2,3-Lutidine-N-oxide can be used in biological study of enzymic reduction of pyridine- and nitropyridine-N-oxide derivs. by ferredoxin-NADP+ oxidoreductase and the role of their electron accepting potency.<br>References Striela, R., et al.: Chemija, 20, 33 (2009)<br></p>Formula:C7H9NOColor and Shape:White To Off-WhiteMolecular weight:123.1532,3-Dimethylpyridine 1-oxide
CAS:Formula:C7H9NOPurity:98%Color and Shape:SolidMolecular weight:123.1552,3-Dimethyl-4-pyridine N-oxide
CAS:<p>2,3-Dimethyl-4-pyridine N-oxide is a reagent that can be used as an oxidant. It reacts with sulfuric acid and hydrogen peroxide to produce nitrate and peracetic acid. This compound has been shown to react with ammonia in the presence of a catalyst to produce nitric oxide, which is useful for environmental pollution control. 2,3-Dimethyl-4-pyridine N-oxide is yellow in color, but turns red when heated or mixed with other compounds.</p>Formula:C7H9NOPurity:Min. 95%Molecular weight:123.15 g/mol








