CymitQuimica logo

CAS 22715-34-0

:

4,5,6-triaminopyrimidin-2(1H)-one

Description:
4,5,6-Triaminopyrimidin-2(1H)-one, with the CAS number 22715-34-0, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features three amino groups (-NH2) at positions 4, 5, and 6, and a carbonyl group (=O) at position 2, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of amino groups that can engage in hydrogen bonding. The compound is of interest in medicinal chemistry and biochemistry, as it may exhibit properties relevant to nucleic acid metabolism and enzyme inhibition. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of antimicrobial or antiviral agents. However, specific applications and biological activities would require further investigation through empirical studies.
Formula:C4H7N5O
InChI:InChI=1/C4H7N5O/c5-1-2(6)8-4(10)9-3(1)7/h5H2,(H5,6,7,8,9,10)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.