CAS 22715-74-8

(1E)-3-(4-bromophenyl)-1-(4-methylphenyl)triaz-1-ene

Description:

(1E)-3-(4-bromophenyl)-1-(4-methylphenyl)triaz-1-ene is an organic compound characterized by its triazene structure, which features a triazole ring connected to phenyl groups. The presence of a bromine atom on one phenyl ring and a methyl group on the other contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound is likely to exhibit interesting electronic properties due to the conjugation between the triazene and the aromatic rings, which can influence its optical and electronic behavior. Additionally, the bromine substituent may enhance its reactivity in electrophilic aromatic substitution reactions, while the methyl group can affect steric hindrance and overall molecular stability. Such compounds are often studied for their potential applications in materials science, pharmaceuticals, and organic synthesis. The specific interactions and behaviors of this compound can be further explored through various analytical techniques, including spectroscopy and chromatography, to understand its reactivity and potential uses in different chemical contexts.

Formula: C₁₃H₁₂BrN₃

InChI: InChI=1/C13H12BrN3/c1-10-2-6-12(7-3-10)15-17-16-13-8-4-11(14)5-9-13/h2-9H,1H3,(H,15,16)

SMILES: Cc1ccc(cc1)N=NNc1ccc(cc1)Br

(1E)-1-(4-bromophenyl)-3-(4-methylphenyl)triaz-1-ene

CAS: 22715-74-8

Formula: C₁₃H₁₂BrN₃

Purity: 95.0%

Molecular weight: 290.164

Ref: 10-F314154