CAS 22717-56-2
:4-Bromo-2-hydroxybenzoic acid methyl ester
Description:
4-Bromo-2-hydroxybenzoic acid methyl ester, with the CAS number 22717-56-2, is an organic compound that belongs to the class of benzoic acid derivatives. It features a bromine atom and a hydroxyl group attached to a benzene ring, along with a methyl ester functional group. This compound is typically characterized by its white to off-white crystalline appearance and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the bromine atom introduces notable reactivity, making it useful in various chemical synthesis applications, including the development of pharmaceuticals and agrochemicals. Additionally, the hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its interactions in biological systems. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled. Overall, 4-Bromo-2-hydroxybenzoic acid methyl ester is a valuable compound in organic chemistry with diverse applications.
Formula:C8H7BrO3
InChI:InChI=1S/C8H7BrO3/c1-12-8(11)6-3-2-5(9)4-7(6)10/h2-4,10H,1H3
InChI key:InChIKey=JEMVEVUWSJXZMX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(O)C=C(Br)C=C1
Synonyms:- 4-Bromo-2-hydroxybenzoic acid methyl ester
- Benzoic Acid, 4-Bromo-2-Hydroxy-, Methyl Ester
- Methyl 4-bromo-2-hydroxybenzenecarboxylate
- Salicylic acid, 4-bromo-, methyl ester
- Methyl 4-bromo-2-hydroxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 4-bromo-2-hydroxybenzoate
CAS:Formula:C8H7BrO3Purity:96%Color and Shape:SolidMolecular weight:231.0434Methyl 4-bromo-2-hydroxybenzoate
CAS:Methyl 4-bromo-2-hydroxybenzoatePurity:94%Color and Shape:SolidMolecular weight:231.04g/mol4-Bromo-2-hydroxybenzoic acid methyl ester
CAS:4-Bromo-2-hydroxybenzoic acid methyl ester is a versatile building block that can be used as a research chemical, reagent, or speciality chemical. It is a high quality, versatile compound that can be used in the synthesis of complex compounds. CAS No. 22717-56-2 is an intermediate for the synthesis of other compounds and has been shown to be a useful scaffold for organic chemistry.Formula:C8H7BrO3Purity:Min. 95%Color and Shape:PowderMolecular weight:231.04 g/molMethyl 4-bromo-2-hydroxybenzoate
CAS:Formula:C8H7BrO3Purity:95%Color and Shape:SolidMolecular weight:231.045



