CAS 227197-72-0

6-chloro-1,3-benzoxazole

Description:

6-Chloro-1,3-benzoxazole is a heterocyclic organic compound characterized by a fused benzene and oxazole ring system, with a chlorine substituent at the 6-position of the benzoxazole moiety. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of biologically active compounds. The presence of the chlorine atom can influence its reactivity and solubility, making it a useful building block in organic synthesis. Additionally, 6-chloro-1,3-benzoxazole may exhibit specific spectral properties, such as UV-Vis and NMR characteristics, which can be utilized for its identification and characterization in laboratory settings. Its stability and reactivity can vary depending on the conditions, such as pH and temperature, making it important to handle it with care in a controlled environment. Overall, this compound is of interest in various fields of research due to its unique structural features and potential utility in chemical synthesis.

Formula: C₇H₄ClNO

InChI: InChI=1/C7H4ClNO/c8-5-1-2-6-7(3-5)10-4-9-6/h1-4H

InChI key: InChIKey=JJOOKXUUVWIARB-UHFFFAOYSA-N

SMILES: c1cc2c(cc1Cl)ocn2

Synonyms:

• 6-Chlorobenzo[d]oxazole
• 6-Chlorobenzoxazole
• Benzoxazole, 6-Chloro-
• 6-Chloro-1,3-benzoxazole

6-Chloro-Benzoxazole

CAS: 227197-72-0

Formula: C₇H₄ClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.5658

Ref: IN-DA00C3HC

6-Chloro-1,3-benzoxazole

CAS: 227197-72-0

6-Chloro-1,3-benzoxazole

Purity: 98%

Molecular weight: 153.57g/mol

Ref: 54-OR400446

6-Chlorobenzo[d]oxazole

CAS: 227197-72-0

Formula: C₇H₄ClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.57

Ref: 10-F228737