CAS 227199-92-0: Sulfonium, triphenyl-, 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonate (1:1)

Description:Sulfonium, triphenyl-, 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonate (1:1) is a chemical compound characterized by its sulfonium ion structure, which features a positively charged sulfur atom bonded to three phenyl groups. This compound is typically used in organic synthesis and photochemistry due to its ability to act as a strong electrophile. The bicyclic structure, derived from bicyclo[2.2.1]heptane, contributes to its unique reactivity and stability. The presence of the methanesulfonate group enhances its solubility in polar solvents, making it suitable for various applications in chemical reactions. Additionally, the compound may exhibit interesting photophysical properties, which can be exploited in light-driven processes. Its specific applications often depend on the context of the reaction and the desired outcomes in synthetic pathways. As with many sulfonium compounds, it is essential to handle this substance with care, considering potential reactivity and toxicity associated with sulfonium salts.

Formula:C₁₈H₁₅S·C₁₀H₁₅O₄S

InChI:InChI=1S/C18H15S.C10H16O4S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h1-15H;7H,3-6H2,1-2H3,(H,12,13,14)/q+1;/p-1

InChI key:InChIKey=FJALTVCJBKZXKY-UHFFFAOYSA-M

SMILES:O=C1CC2CCC1(CS(=O)(=O)[O-])C2(C)C.C=1C=CC(=CC1)[S+](C=2C=CC=CC2)C=3C=CC=CC3

Synonyms:
Sulfonium, triphenyl-, salt with 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonic acid (1:1)
Triphenylsulfonium 10-camphorsulfonate
WPAG 567
Sulfonium, triphenyl-, 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonate (1:1)
Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, ion(1-), triphenylsulfonium