CAS 2272-40-4
:4,6-dichloro-N-phenyl-1,3,5-triazin-2-amine
Description:
4,6-Dichloro-N-phenyl-1,3,5-triazin-2-amine, with the CAS number 2272-40-4, is a chemical compound that belongs to the class of triazines, which are characterized by a six-membered ring containing three nitrogen atoms. This compound features two chlorine substituents at the 4 and 6 positions of the triazine ring, and a phenyl group attached to the nitrogen at the 1 position. It is typically used in agricultural applications, particularly as a herbicide due to its ability to inhibit specific biochemical pathways in plants. The presence of chlorine atoms enhances its stability and effectiveness as a pesticide. In terms of physical properties, it is generally a solid at room temperature and may exhibit low solubility in water, while being more soluble in organic solvents. Safety data indicates that it should be handled with care, as it may pose environmental and health risks if not managed properly. Overall, 4,6-dichloro-N-phenyl-1,3,5-triazin-2-amine is significant in agricultural chemistry for its herbicidal properties.
Formula:C9H6Cl2N4
InChI:InChI=1/C9H6Cl2N4/c10-7-13-8(11)15-9(14-7)12-6-4-2-1-3-5-6/h1-5H,(H,12,13,14,15)
SMILES:c1ccc(cc1)N=c1[nH]c(Cl)nc(Cl)n1
Synonyms:- 1,3,5-Triazin-2-amine, 4,6-dichloro-N-phenyl-
- 4,6-Dichloro-N-phenyl-1,3,5-triazin-2-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4,6-Dichloro-N-phenyl-1,3,5-triazin-2-amine
CAS:Formula:C9H6Cl2N4Purity:98%Color and Shape:SolidMolecular weight:241.07674,6-Dichloro-N-phenyl-1,3,5-triazin-2-amine
CAS:4,6-Dichloro-N-phenyl-1,3,5-triazin-2-aminePurity:98%Molecular weight:241.08g/mol4,6-Dichloro-N-phenyl-1,3,5-triazin-2-amine
CAS:<p>4,6-Dichloro-N-phenyl-1,3,5-triazin-2-amine is a reactive and labile compound that has been shown to inhibit the nuclear factor kappa B (NF-κB). It is an analog of 2,4,6,-trichlorophenyl-1,3,5-triazine. 4,6-Dichloro-N-phenylsulfonyl triazin-2 amine is a chlorinated derivative of 4,6 dichloro triazin 2 amine. The chlorine atom in the molecule may be replaced with a cyanuric or chloride group. This chemical compound is used in dyestuffs and as a precursor for other chemicals. The effect varies depending on the dose administered.</p>Formula:C9H6Cl2N4Purity:Min. 95%Molecular weight:241.08 g/mol


