CymitQuimica logo

CAS 2272-83-5

:

N-[(1S,2R)-2-hydroxy-1-methyl-2-phenylethyl]-N-methylacetamide

Description:
N-[(1S,2R)-2-hydroxy-1-methyl-2-phenylethyl]-N-methylacetamide, with the CAS number 2272-83-5, is an organic compound characterized by its amide functional group. This substance features a chiral center, which contributes to its stereochemistry, specifically the (1S,2R) configuration. The presence of a hydroxyl group (-OH) and a methyl group (-CH3) attached to the phenylethyl backbone enhances its solubility in polar solvents. The compound is likely to exhibit moderate to high polarity due to these functional groups. Additionally, the acetamide moiety suggests potential for hydrogen bonding, which can influence its physical properties such as boiling point and solubility. This compound may have applications in pharmaceuticals or as a biochemical reagent, although specific uses would depend on its biological activity and interactions. Its stability and reactivity would be influenced by the presence of the hydroxyl and amide groups, making it a subject of interest in organic synthesis and medicinal chemistry.
Formula:C12H17NO2
InChI:InChI=1/C12H17NO2/c1-9(13(3)10(2)14)12(15)11-7-5-4-6-8-11/h4-9,12,15H,1-3H3/t9-,12-/m0/s1
SMILES:C[C@@H]([C@@H](c1ccccc1)O)N(C)C(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.