CAS 22729-75-5
:N-Phenyl-N-[(1,1,2,2-tetrachloro-2-fluoroethyl)thio]methanesulfonamide
Description:
N-Phenyl-N-[(1,1,2,2-tetrachloro-2-fluoroethyl)thio]methanesulfonamide, with CAS number 22729-75-5, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a phenyl group attached to a sulfonamide moiety, indicating potential applications in pharmaceuticals or agrochemicals. The presence of the tetrachloro-2-fluoroethyl group suggests that it may exhibit unique reactivity and stability due to the halogen substituents, which can influence its biological activity and environmental persistence. The sulfonamide structure typically enhances solubility in polar solvents, while the halogenated ethyl group may contribute to lipophilicity. Overall, this compound's specific characteristics, including its molecular weight, melting point, and solubility, would be essential for understanding its behavior in various chemical environments and potential applications in medicinal chemistry or material science. Safety and handling precautions are necessary due to the presence of halogens, which can pose health and environmental risks.
Formula:C9H8Cl4FNO2S2
InChI:InChI=1S/C9H8Cl4FNO2S2/c1-19(16,17)15(7-5-3-2-4-6-7)18-9(12,13)8(10,11)14/h2-6H,1H3
InChI key:InChIKey=SVIKNKPDPGCMAE-UHFFFAOYSA-N
SMILES:N(SC(C(Cl)(Cl)F)(Cl)Cl)(S(C)(=O)=O)C1=CC=CC=C1
Synonyms:- Ai3-27512
- Arboren F 11
- Brn 2877693
- Methanesulfonamide, N-((1,1,2,2-tetrachloro-2-fluoroethyl)thio)- (8CI)
- Methanesulfonamide, N-phenyl-N-((1,1,2,2-tetrachloro-2-fluoroethyl)thio)- (9CI)
- Methanesulfonamide, N-phenyl-N-[(1,1,2,2-tetrachloro-2-fluoroethyl)thio]-
- Methanesulfonanilide, N-((tetrachloro-2-fluoroethyl)thio)-
- Methanesulfonanilide, N-[(1,1,2,2-tetrachloro-2-fluoroethyl)thio]-
- N-((Tetrachloro-2-fluoroethyl)thio)methanesulfoanilide
- N-(2-Fluoro-1,1,2,2-tetrachloroethylthio)-N-phenylmethanesulfonamide
- N-(2-Fluoro-1,1,2,2-tetrachloroethylthio)-methanesulfoanilide
- N-Phenyl-N-[(1,1,2,2-tetrachloro-2-fluoroethyl)thio]methanesulfonamide
- N-[(1,1,2,2-Tetrachloro-2-fluoroethyl)thio]-N-methylsulfonylaniline
- N-phenyl-N-[(1,1,2,2-tetrachloro-2-fluoroethyl)sulfanyl]methanesulfonamide
- R-10044
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.