
CAS 22734-10-7
:1-Nitrosotricyclo[3.3.1.13,7]decane
Description:
1-Nitrosotricyclo[3.3.1.1^3,7]decane is a chemical compound characterized by its unique bicyclic structure, which consists of a tricyclic framework with a nitroso functional group. This compound is part of the class of nitroso compounds, which are known for their potential reactivity and biological activity. The presence of the nitroso group (-NO) can influence the compound's stability and reactivity, making it of interest in various chemical and biological studies. Typically, nitroso compounds can participate in reactions such as nitrosation and can act as intermediates in organic synthesis. The specific arrangement of carbon atoms in the tricyclic structure contributes to its steric and electronic properties, which can affect its interactions with other molecules. Additionally, compounds like 1-nitrosotricyclo[3.3.1.1^3,7]decane may exhibit unique physical properties, such as solubility and volatility, depending on their molecular structure. Safety considerations are important when handling such compounds due to their potential toxicity and reactivity.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c12-11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2
InChI key:InChIKey=NXYRRNWKCSMROR-UHFFFAOYSA-N
SMILES:N(=O)C12CC3CC(C1)CC(C2)C3
Synonyms:- 1-Nitrosoadamantane
- Adamantane, 1-nitroso-
- 1-Nitrosotricyclo[3.3.1.13,7]decane
- Tricyclo[3.3.1.13,7]decane, 1-nitroso-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Nitrosoadamantane
CAS:<p>1-Nitrosoadamantane is a bioactive chemical.</p>Formula:C10H15NOColor and Shape:SolidMolecular weight:165.23
