CAS 22737-33-3

Methylbistrimethylsilylhydroxylamine

Description:

Methylbistrimethylsilylhydroxylamine, with the CAS number 22737-33-3, is a chemical compound characterized by its unique structure that includes a hydroxylamine functional group and trimethylsilyl groups. This compound is typically used in organic synthesis and as a reagent in various chemical reactions, particularly in the field of silicon chemistry. It exhibits properties such as being a colorless to pale yellow liquid, with a relatively low volatility and a moderate solubility in organic solvents. The presence of trimethylsilyl groups enhances its stability and reactivity, making it useful in protecting functional groups during chemical transformations. Additionally, hydroxylamines are known for their ability to form oximes with carbonyl compounds, which can be a crucial step in synthetic pathways. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective equipment should be used. Overall, Methylbistrimethylsilylhydroxylamine is a valuable reagent in synthetic organic chemistry.

Formula: C₇H₂₁NOSi₂

InChI: InChI=1/C7H21NOSi2/c1-8(10(2,3)4)9-11(5,6)7/h1-7H3

SMILES: CN(O[Si](C)(C)C)[Si](C)(C)C

Synonyms:

• N-Methyl-N,O-bis(trimethylsilyl)hydroxylamine

N-Methyl-N,O-bis(trimethylsilyl)hydroxylamine

CAS: 22737-33-3

Formula: C₇H₂₁NOSi₂

Molecular weight: 191.4187

Ref: IN-DA003T84

N-Methyl-N,O-bis(trimethylsilyl)hydroxylamine

CAS: 22737-33-3

Formula: C₇H₂₁NOSi₂

Purity: >98.0%(T)

Color and Shape: Colorless to Light yellow to Light orange clear liquid

Molecular weight: 191.42

Ref: 3B-M1077