CAS 22739-76-0: 2-Propan-1,1,1,2,3,3,3-d7-ol-d
Description:2-Propan-1,1,1,2,3,3,3-d7-ol-d, also known as deuterated isopropanol, is a deuterated form of isopropanol where specific hydrogen atoms are replaced with deuterium, a stable isotope of hydrogen. This compound is characterized by its molecular formula, which reflects the presence of deuterium, leading to distinct physical and chemical properties compared to its non-deuterated counterpart. It typically appears as a colorless liquid with a characteristic alcohol odor. The presence of deuterium can affect the compound's boiling point, density, and infrared absorption characteristics, making it useful in various applications, particularly in NMR spectroscopy and other analytical techniques where isotopic labeling is beneficial. Additionally, 2-Propan-1,1,1,2,3,3,3-d7-ol-d is utilized in research settings to study reaction mechanisms and molecular interactions due to the unique properties imparted by deuterium. As with other alcohols, it is expected to exhibit typical alcohol reactivity, including oxidation and esterification, albeit with kinetic differences due to the isotopic substitution.
Formula:C3D8O
InChI:InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3/i1D3,2D3,3D,4D
InChI key:InChIKey=KFZMGEQAYNKOFK-PIODKIDGSA-N
SMILES:OC(C)C
- Synonyms:
- (~2~H_7_)propan-2-(~2~H)ol
- 1,1,1,2,3,3,3-Heptadeuterio-2-deuteriooxypropane
- 2-Propan-1,1,1,2,3,3,3-d<sub>7</sub>-ol-d
- 2-Propanol-d8
- 2-Propanol-d<sub>8</sub>
- IPA-d8
- Isopropanol-d<sub>8</sub>
- Isopropyl alcohol-d8
- Isopropyl-d<sub>7</sub> alcohol-d
- Propan-2-Ol
- See more synonyms
- 2-Propan-1,1,1,2,3,3,3-d7-ol-d
- Isopropanol-d8
- Isopropyl-d7 alcohol-d
