CAS 227607-45-6: Cyclobutanecarboxylic acid, 3,3-difluoro-1-methyl-, ethyl ester
Description:Cyclobutanecarboxylic acid, 3,3-difluoro-1-methyl-, ethyl ester, identified by CAS number 227607-45-6, is an organic compound characterized by its cyclobutane ring structure, which is a four-membered carbon ring. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit acidic properties. The difluoromethyl substituent at the 3,3-positions introduces significant electronegativity, potentially influencing the compound's reactivity and polarity. The ethyl ester group suggests that this compound can undergo hydrolysis to yield the corresponding acid and alcohol, making it relevant in various synthetic applications. Additionally, the presence of fluorine atoms may enhance the compound's stability and lipophilicity, affecting its solubility in organic solvents. Overall, this compound's unique structure and functional groups make it of interest in fields such as medicinal chemistry and materials science, where fluorinated compounds often exhibit distinct biological and physical properties.
Formula:C8H12F2O2
InChI:InChI=1S/C8H12F2O2/c1-3-12-6(11)7(2)4-8(9,10)5-7/h3-5H2,1-2H3
InChI key:InChIKey=XPJJHWLCLJNZCY-UHFFFAOYSA-N
SMILES:O=C(OCC)C1(C)CC(F)(F)C1
- Synonyms:
- Ethyl 3,3-difluoro-1-methylcyclobutanecarboxylate
- Cyclobutanecarboxylic acid, 3,3-difluoro-1-methyl-, ethyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Ethyl 3,3-difluoro-1-methylcyclobutane-1-carboxylate REF: 54-PC908371CAS: 227607-45-6 | - - - | 905.00 €~1,237.00 € | Thu 24 Apr 25 |
![]() | ETHYL 3,3-DIFLUORO-1-METHYLCYCLOBUTANECARBOXYLATE REF: 10-F503646CAS: 227607-45-6 | 95.0% | - - - | Discontinued product |
![]() | Ethyl 3,3-difluoro-1-methylcyclobutane-1-carboxylate REF: 3D-CJA60745CAS: 227607-45-6 | Min. 95% | - - - | Discontinued product |

Ref: 54-PC908371
1g | 1,237.00 € | ||
500mg | 905.00 € |

ETHYL 3,3-DIFLUORO-1-METHYLCYCLOBUTANECARBOXYLATE
Ref: 10-F503646
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
500mg | Discontinued | Request information |

Ethyl 3,3-difluoro-1-methylcyclobutane-1-carboxylate
Ref: 3D-CJA60745
1g | Discontinued | Request information | |
100mg | Discontinued | Request information |