CAS 22767-72-2
:Ethyl 3-(4-methoxyphenyl)propanoate
Description:
Ethyl 3-(4-methoxyphenyl)propanoate, with the CAS number 22767-72-2, is an organic compound that belongs to the class of esters. It is characterized by its ethyl ester functional group, which is derived from the reaction of ethanol and a carboxylic acid. The compound features a propanoate backbone with a 4-methoxyphenyl substituent, contributing to its aromatic properties. Ethyl 3-(4-methoxyphenyl)propanoate is typically a colorless to pale yellow liquid with a pleasant, fruity odor, making it potentially useful in flavor and fragrance applications. Its molecular structure includes carbon, hydrogen, and oxygen atoms, which confer various chemical properties such as solubility in organic solvents and moderate volatility. The presence of the methoxy group enhances its reactivity and can influence its interactions in chemical reactions. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C12H16O3
InChI:InChI=1/C12H16O3/c1-3-15-12(13)9-6-10-4-7-11(14-2)8-5-10/h4-5,7-8H,3,6,9H2,1-2H3
SMILES:CCOC(=O)CCc1ccc(cc1)OC
Synonyms:- 3-(4-Methoxyphenyl)propionic acid ethyl ester
- Benzenepropanoic Acid, 4-Methoxy-, Ethyl Ester
- Ethyl 4-methoxybenzenepropanoate
- Ethyl 3-(4-Methoxylphenyl)Propanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 3-(4-methoxyphenyl)propanoate
CAS:Formula:C12H16O3Purity:97%Color and Shape:LiquidMolecular weight:208.2536Ethyl 3-(4-methoxyphenyl)propanoate
CAS:Ethyl 3-(4-methoxyphenyl)propanoatePurity:98%Color and Shape:SolidMolecular weight:208.25g/molEthyl 3-(4-methoxyphenyl)propanoate
CAS:Ethyl 3-(4-methoxyphenyl)propanoate is a natural product for research related to life sciences. The catalog number is TN4019 and the CAS number is 22767-72-2.Formula:C12H16O3Purity:98.37%Color and Shape:SolidMolecular weight:208.25Ethyl 3-(4-methoxyphenyl)propanoate
CAS:Formula:C12H16O3Purity:95%~99%Color and Shape:OilMolecular weight:208.257




