CAS 22775-52-6
:mycelianamide
Description:
Mycelianamide, with the CAS number 22775-52-6, is a chemical compound that belongs to the class of amides. It is characterized by the presence of an amide functional group, which consists of a carbonyl group (C=O) directly attached to a nitrogen atom (N). This compound is typically studied for its potential applications in various fields, including pharmaceuticals and biochemistry. Mycelianamide may exhibit properties such as solubility in polar solvents, stability under certain conditions, and the ability to participate in hydrogen bonding due to its amide structure. The specific reactivity and biological activity of mycelianamide can vary based on its molecular structure and the presence of substituents. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information. Overall, mycelianamide represents a compound of interest in chemical research, particularly for its potential utility in synthetic and medicinal chemistry.
Formula:C22H28N2O5
InChI:InChI=1/C22H28N2O5/c1-15(2)6-5-7-16(3)12-13-29-19-10-8-18(9-11-19)14-20-22(26)23(27)17(4)21(25)24(20)28/h6,8-12,14,17,27-28H,5,7,13H2,1-4H3/b16-12+,20-14+/t17-/m0/s1
Synonyms:- 22775-52-6
- 3-[[4-[(3,7-Dimethyl-2,6-octadienyl)oxy]phenyl]methylene]-1,4-dihydroxy-6-methyl-2,5-piperazinedione
- 2,5-Piperazinedione, 3-[[4-[[(2E)-3,7-dimethyl-2,6-octadien-1-yl]oxy]phenyl]methylene]-1,4-dihydroxy-6-methyl-, (6S)-
- mycelianamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mycelianamide
CAS:<p>Mycelianamide is an antibiotic effective against Gram-positive bacteria.</p>Formula:C22H28N2O5Color and Shape:SolidMolecular weight:400.468
