CAS 22780-32-1

2-{[(2E)-3-(4-methoxyphenyl)prop-2-enoyl]amino}benzoate

Description:

The chemical substance known as 2-{[(2E)-3-(4-methoxyphenyl)prop-2-enoyl]amino}benzoate, with the CAS number 22780-32-1, is an organic compound that features a complex structure comprising both aromatic and aliphatic components. It contains a benzoate moiety, which is derived from benzoic acid, and an enoyl group that is conjugated with an amino group, indicating potential for various chemical interactions. The presence of a methoxy group on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit properties typical of both amides and esters, such as moderate solubility in organic solvents and potential reactivity towards nucleophiles. Its structural characteristics suggest that it may have applications in pharmaceuticals or as a biochemical probe, although specific biological activities would depend on further empirical studies. Overall, the compound's unique functional groups and structural features make it a subject of interest in organic synthesis and medicinal chemistry.

Formula: C₁₇H₁₄NO₄

InChI: InChI=1/C17H15NO4/c1-22-13-9-6-12(7-10-13)8-11-16(19)18-15-5-3-2-4-14(15)17(20)21/h2-11H,1H3,(H,18,19)(H,20,21)/p-1/b11-8+

2-(3-(4-Methoxyphenyl)acrylamido)benzoic acid

CAS: 22780-32-1

Formula: C₁₇H₁₅NO₄

Molecular weight: 297.3053

Ref: IN-DA00BGHC

2-{[(2E)-3-(4-Methoxyphenyl)prop-2-enoyl]amino}benzoic acid

CAS: 22780-32-1

2-{[(2E)-3-(4-Methoxyphenyl)prop-2-enoyl]amino}benzoic acid is a carboxamide, benzoic acid, anthranilic acid, and anthranilic. It has been shown to inhibit the growth of Mycobacterium tuberculosis and Mycobacterium avium complex. This compound also has anti-inflammatory properties that may be due to its ability to inhibit prostaglandin synthesis.

Formula: C₁₇H₁₅NO₄

Purity: Min. 95%

Molecular weight: 297.3 g/mol

Ref: 3D-XAA78032