CAS 22788-18-7
:Carboxyphosphamide
Description:
Carboxyphosphamide, with the CAS number 22788-18-7, is a chemical compound that belongs to the class of phosphamide derivatives. It is characterized by the presence of both carboxylic acid and phosphamide functional groups, which contribute to its reactivity and potential applications in various fields. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its polar nature due to the functional groups present. Carboxyphosphamide is of interest in medicinal chemistry, particularly for its potential use in pharmaceuticals, as it may exhibit biological activity related to its structural features. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Additionally, it may undergo hydrolysis, leading to the release of phosphoric acid and other byproducts. As with many phosphamide compounds, safety precautions should be taken when handling Carboxyphosphamide due to potential toxicity and reactivity. Overall, its unique chemical structure makes it a subject of interest for further research and application in various chemical and biological contexts.
Formula:C7H15Cl2N2O4P
InChI:InChI=1S/C7H15Cl2N2O4P/c8-2-4-11(5-3-9)16(10,14)15-6-1-7(12)13/h1-6H2,(H2,10,14)(H,12,13)
InChI key:InChIKey=QLAKAJLYYGOZQL-UHFFFAOYSA-N
SMILES:N(P(OCCC(O)=O)(N)=O)(CCCl)CCCl
Synonyms:- 3-[[Amino[bis(2-chloroethyl)amino]phosphinyl]oxy]propanoic acid
- Asta 5754
- Carboxycyclophosphamide
- Carboxyphosphamide
- Hydracrylic acid, N,N-bis(2-chloroethyl)phosphorodiamidate
- N,N-Bis(2-chloroethyl)-O-2-carboxyethylphosphorodiamide
- NSC 145124
- O-(2-Carboxyethyl) N,N-bis(2-chloroethyl)phosphorodiamidate
- Phosphorodiamidic acid, N,N-bis(2-chloroethyl)-, ester with hydracrylic acid
- Propanoic Acid, 3-[[Amino[Bis(2-Chloroethyl)Amino]Phosphinyl]Oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Cyclophosphamide Impurity 25 (Carboxyphosphamide)
CAS:Formula:C7H15Cl2N2O4PColor and Shape:White To Off-White SolidMolecular weight:293.08Carboxyphosphamide
CAS:Carboxyphosphamide, an inactive byproduct, forms from cyclophosphamide via aldophosphamide oxidation.Formula:C7H15Cl2N2O4PColor and Shape:SolidMolecular weight:293.08Carboxyphosphamide
CAS:Controlled ProductApplications A metabolite of Cyclophosphamide (CPA) (C988580).
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Takamizawa, A., et al.: J. Med. Chem., 18, 376 (1975), Jones, R.J., et al.: J. Hematother., 1, 343 (1992), Biggs, D., et al.: Prog. Clin. Biol. Res., 389, 9 (1994),Formula:C7H15Cl2N2O4PColor and Shape:NeatMolecular weight:293.08



