CAS 2279-76-7
:Tripropyltin chloride
Description:
Tripropyltin chloride, with the CAS number 2279-76-7, is an organotin compound characterized by its three propyl groups attached to a tin atom, along with a chloride ion. It appears as a colorless to pale yellow liquid and is known for its high lipophilicity, which allows it to easily penetrate biological membranes. This compound is primarily used as a biocide and fungicide in various applications, including agriculture and wood preservation, due to its effectiveness against a wide range of pests and fungi. Tripropyltin chloride exhibits toxicity to aquatic organisms and can pose environmental risks, necessitating careful handling and regulation. Its chemical structure contributes to its stability and reactivity, making it a subject of interest in both industrial and environmental chemistry. Additionally, it can undergo hydrolysis in the presence of water, leading to the formation of tripropyltin hydroxide, which has different properties and applications. Overall, tripropyltin chloride is significant in both practical applications and environmental considerations.
Formula:C9H21ClSn
InChI:InChI=1S/3C3H7.ClH.Sn/c3*1-3-2;;/h3*1,3H2,2H3;1H;/q;;;;+1/p-1
InChI key:InChIKey=FVFLIQMADUVDSP-UHFFFAOYSA-M
SMILES:[Sn](CCC)(CCC)(CCC)Cl
Synonyms:- Chloro(Tripropyl)Stannane
- Chlorotripropylstannane
- Chlorotripropyltin
- Stannane, chlorotripropyl-
- Tin, chlorotripropyl-
- Tri-n-propylchlorotin
- Tripropylchlorostannane
- Tripropylstannanylium Chloride
- Tripropylstannyl chloride
- Tripropyltin chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Tri-n-propyltin chloride, 98+%
CAS:Tri-n-propyltin chloride, 98+%
Formula:(C3H7)3SnClPurity:98+%Color and Shape:colorless liq.Molecular weight:283.41Tri-n-propyltin chloride
CAS:Controlled ProductFormula:C9H21ClSnColor and Shape:NeatMolecular weight:283.43tri-n-Propyltin Chloride
CAS:Controlled ProductApplications tri-n-Propyltin Chloride functions as a RXR agonists. An antifouling agents.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Nakanishi, T., et al.: Mol. Endocrinol., 19, 2502 (2005); Tolosa, I., et al.: Analytica Chimica Acta, 335, 267 (1996)Formula:C9H21ClSnColor and Shape:ColourlessMolecular weight:283.43Stannane, chlorotripropyl-
CAS:Stannane, chlorotripropyl- is a type of molecule that has been shown to have hemolytic activity. It also helps to increase the uptake of cationic surfactants. The hemolytic activity of this molecule has been shown in dietary concentrations and in hl-60 cells. Analytical methods for the detection of this molecule include trimethyltin chloride plasma mass spectrometry and organometallic matrix effect. Disulfide bond can be used to identify this molecule with a matrix effect.Formula:C9H21ClSnPurity:Min. 95%Molecular weight:283.42 g/mol



