CymitQuimica logo

CAS 2280-89-9

:

3-Amino-2,4,6-triiodo-5-[(methylamino)carbonyl]benzoic acid

Description:
3-Amino-2,4,6-triiodo-5-[(methylamino)carbonyl]benzoic acid, with the CAS number 2280-89-9, is a chemical compound characterized by its complex structure, which includes multiple iodine substituents on a benzoic acid framework. This compound features an amino group and a methylamino carbonyl group, contributing to its potential as a pharmaceutical or diagnostic agent. The presence of three iodine atoms enhances its radiological properties, making it useful in medical imaging, particularly in nuclear medicine. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid functional group, while the iodine substituents may influence its reactivity and stability. Its molecular structure suggests potential interactions with biological systems, which could be explored for therapeutic applications. Additionally, the presence of multiple functional groups indicates that it may participate in various chemical reactions, including acylation and amination. Overall, this compound's unique characteristics make it a subject of interest in both organic chemistry and medicinal applications.
Formula:C9H7I3N2O3
InChI:InChI=1S/C9H7I3N2O3/c1-14-8(15)2-4(10)3(9(16)17)6(12)7(13)5(2)11/h13H2,1H3,(H,14,15)(H,16,17)
InChI key:InChIKey=AKXKBAWZIVNNJR-UHFFFAOYSA-N
SMILES:C(NC)(=O)C1=C(I)C(C(O)=O)=C(I)C(N)=C1I
Synonyms:
  • 3-Amino-2,4,6-Triiodo-5-(Methylcarbamoyl)Benzoic Acid
  • 5-Amino-2,4,6-triiodo-N-methylisophthalamic acid
  • Benzoic acid, 3-amino-2,4,6-triiodo-5-[(methylamino)carbonyl]-
  • Isophthalamic acid, 5-amino-2,4,6-triiodo-N-methyl-
  • 3-Amino-2,4,6-triiodo-5-[(methylamino)carbonyl]benzoic acid
  • 3-Amino-2,4,6-triiodo-5-((methylamino)carbonyl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.