CAS 22802-67-1
:Benzoic acid, 5-amino-2-methoxy-, methyl ester
Description:
Benzoic acid, 5-amino-2-methoxy-, methyl ester, also known by its CAS number 22802-67-1, is an organic compound characterized by its benzoic acid structure modified with an amino group and a methoxy group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its ester functional group. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and solubility in various environments. The methoxy group contributes to its overall polarity and can affect its interaction with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its synthesis often involves esterification reactions, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C9H11NO3
InChI:InChI=1S/C9H11NO3/c1-12-8-4-3-6(10)5-7(8)9(11)13-2/h3-5H,10H2,1-2H3
InChI key:InChIKey=PSCXCIPPRCFAAO-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(OC)C=CC(N)=C1
Synonyms:- Benzoic acid, 5-amino-2-methoxy-, methyl ester
- Methyl 2-methoxy-5-aminobenzoate
- Methyl 5-Amino-2-Methoxybenzoate
- o-Anisic acid, 5-amino-, methyl ester
- Methyl 5-amino-o-anisate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 5-amino-2-methoxybenzoate
CAS:Formula:C9H11NO3Purity:98%Color and Shape:SolidMolecular weight:181.1885Methyl 5-amino-2-methoxybenzoate
CAS:Methyl 5-amino-2-methoxybenzoatePurity:95%Molecular weight:181.19g/mol5-Amino-2-methoxy-benzoic acid methyl ester
CAS:<p>5-Amino-2-methoxy-benzoic acid methyl ester is a synthetic compound that has been shown to have potential as an antibacterial. It has been found to inhibit the growth of bacteria by binding to DNA and preventing transcription. The selectivity for bacterial cells is due to its ability to penetrate the cell membrane, which does not occur in mammalian cells. 5-Amino-2-methoxy-benzoic acid methyl ester is synthesized from 2-(4′-aminophenyl)acetic acid and methoxymethyl chloride in two steps, with a yield of 60%.</p>Formula:C9H11NO3Purity:Min. 95%Color and Shape:Red PowderMolecular weight:181.19 g/molMethyl 5-Amino-2-methoxybenzoate
CAS:Formula:C9H11NO3Purity:98%Color and Shape:Liquid, ViscousMolecular weight:181.191



