CAS 22804-49-5

1-hydroxy-2,3,5-trimethoxy-9H-xanthen-9-one

Description:

1-Hydroxy-2,3,5-trimethoxy-9H-xanthen-9-one, with the CAS number 22804-49-5, is a synthetic organic compound belonging to the xanthenone class. This compound is characterized by its xanthone core structure, which features a hydroxyl group and three methoxy groups at specific positions on the aromatic rings. The presence of these functional groups contributes to its potential biological activity, including antioxidant properties. The compound is typically a yellow to orange solid, exhibiting solubility in organic solvents such as ethanol and dimethyl sulfoxide, while being less soluble in water. Its unique structure allows for various applications in fields such as organic synthesis, dye production, and potentially in pharmaceuticals due to its bioactive properties. Additionally, the compound may exhibit fluorescence, making it useful in analytical chemistry and as a fluorescent probe. Overall, 1-hydroxy-2,3,5-trimethoxy-9H-xanthen-9-one is a versatile compound with significant implications in both research and industrial applications.

Formula: C₁₆H₁₄O₆

InChI: InChI=1/C16H14O6/c1-19-9-6-4-5-8-13(17)12-10(22-15(8)9)7-11(20-2)16(21-3)14(12)18/h4-7,18H,1-3H3

SMILES: COc1cccc2c(=O)c3c(cc(c(c3O)OC)OC)oc12

Synonyms:

• 1-Hydroxy-2,3,5-trimethoxy xanthone
• 1-Hydroxy-2,3,5-trimethoxyxanthone
• 9H-Xanthen-9-one, 1-hydroxy-2,3,5-trimethoxy-

1-Hydroxy-2,3,5-trimethoxyxanthone

CAS: 22804-49-5

Formula: C₁₆H₁₄O₆

Color and Shape: Solid

Molecular weight: 302.2788

Ref: IN-DA007NPS

1-Hydroxy-2,3,5-trimethoxyxanthone

CAS: 22804-49-5

1-Hydroxy-2,3,5-trimethoxyxanthone (HM-1) has vasodilator action ,which involves both an endothelium-dependent mechanism involving NO and an endothelium-

Formula: C₁₆H₁₄O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 302.28

Ref: TM-TN2534

1-Hydroxy-2,3,5-trimethoxyxanthone

CAS: 22804-49-5

Formula: C₁₆H₁₄O₆

Purity: 95%~99%

Molecular weight: 302.282

Ref: BP-SBP03166

1-Hydroxy-2,3,5-trimethoxyxanthone

CAS: 22804-49-5

1-Hydroxy-2,3,5-trimethoxyxanthone is a xanthone derivative, which is a class of compounds known for their diverse biological activities. This compound is typically sourced from various plant species, particularly those within the Gentianaceae family. It is often isolated using advanced extraction techniques such as solvent extraction followed by chromatographic purification.

Formula: C₁₆H₁₄O₆

Purity: Min. 95%

Molecular weight: 302.28 g/mol

Ref: 3D-XAA80449