CAS 22804-49-5: 1-hydroxy-2,3,5-trimethoxy-9H-xanthen-9-one

Description:1-Hydroxy-2,3,5-trimethoxy-9H-xanthen-9-one, with the CAS number 22804-49-5, is a synthetic organic compound belonging to the xanthenone class. This compound is characterized by its xanthone core structure, which features a hydroxyl group and three methoxy groups at specific positions on the aromatic rings. The presence of these functional groups contributes to its potential biological activity, including antioxidant properties. The compound is typically a yellow to orange solid, exhibiting solubility in organic solvents such as ethanol and dimethyl sulfoxide, while being less soluble in water. Its unique structure allows for various applications in fields such as organic synthesis, dye production, and potentially in pharmaceuticals due to its bioactive properties. Additionally, the compound may exhibit fluorescence, making it useful in analytical chemistry and as a fluorescent probe. Overall, 1-hydroxy-2,3,5-trimethoxy-9H-xanthen-9-one is a versatile compound with significant implications in both research and industrial applications.

Formula:C₁₆H₁₄O₆

InChI:InChI=1/C16H14O6/c1-19-9-6-4-5-8-13(17)12-10(22-15(8)9)7-11(20-2)16(21-3)14(12)18/h4-7,18H,1-3H3

Synonyms:
1-Hydroxy-2,3,5-trimethoxy xanthone
1-Hydroxy-2,3,5-trimethoxyxanthone
9H-Xanthen-9-one, 1-hydroxy-2,3,5-trimethoxy-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1-Hydroxy-2,3,5-trimethoxyxanthone REF: IN-DA007NPSCAS: 22804-49-5	- - -	To inquire	Mon 14 Apr 25
1-Hydroxy-2,3,5-trimethoxyxanthone REF: TM-TN2534CAS: 22804-49-5	98%	To inquire	Tue 15 Apr 25
1-Hydroxy-2,3,5-trimethoxyxanthone REF: BP-SBP03166CAS: 22804-49-5	95%~99%	To inquire	Thu 17 Apr 25
1-Hydroxy-2,3,5-trimethoxyxanthone REF: 3D-XAA80449CAS: 22804-49-5	Min. 95%	331.00 €~3,537.00 €	Tue 27 May 25