CAS 228107-82-2

[3,5-bis(trifluoromethyl)phenyl](hydroxy)acetic acid

Description:

[3,5-bis(trifluoromethyl)phenyl](hydroxy)acetic acid is a chemical compound characterized by its unique structure, which includes a phenyl ring substituted with two trifluoromethyl groups at the 3 and 5 positions, along with a hydroxyacetic acid functional group. This compound is notable for its high lipophilicity due to the presence of the trifluoromethyl groups, which can enhance its biological activity and influence its interactions with biological systems. The hydroxy group contributes to its potential as a weak acid, allowing it to participate in hydrogen bonding and potentially affecting its solubility in various solvents. The presence of fluorine atoms often imparts unique electronic properties, making this compound of interest in medicinal chemistry and materials science. Additionally, its structural features may lead to interesting pharmacological properties, making it a candidate for further research in drug development or as a chemical intermediate in synthetic applications. Overall, [3,5-bis(trifluoromethyl)phenyl](hydroxy)acetic acid exemplifies the intersection of organic chemistry and functional design in creating compounds with specific desired characteristics.

Formula: C₁₀H₆F₆O₃

InChI: InChI=1/C10H6F6O3/c11-9(12,13)5-1-4(7(17)8(18)19)2-6(3-5)10(14,15)16/h1-3,7,17H,(H,18,19)

SMILES: c1c(cc(cc1C(F)(F)F)C(F)(F)F)C(C(=O)O)O

Synonyms:

• Benzeneacetic acid, alpha-hydroxy-3,5-bis(trifluoromethyl)-

3,5-Bis(trifluoromethyl)mandelic acid

CAS: 228107-82-2

Formula: C₁₀H₆F₆O₃

Purity: 96.0%

Color and Shape: Solid

Molecular weight: 288.145

Ref: 10-F019264