CAS 228120-29-4
:Phosphonic acid, [3-(trimethylsilyl)-2-propynyl]-, dimethyl ester
Description:
Phosphonic acid, [3-(trimethylsilyl)-2-propynyl]-, dimethyl ester, identified by CAS number 228120-29-4, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group and two methyl ester groups. This compound features a trimethylsilyl group attached to a propynyl chain, which enhances its stability and solubility in organic solvents. The presence of the phosphonic acid moiety imparts unique reactivity, making it useful in various chemical applications, including as a potential building block in organic synthesis and as a ligand in coordination chemistry. The trimethylsilyl group can also provide protective characteristics, allowing for selective reactions in multi-step synthesis. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups, making it a versatile compound in both industrial and research settings.
Formula:C8H17O3PSi
InChI:InChI=1S/C8H17O3PSi/c1-10-12(9,11-2)7-6-8-13(3,4)5/h7H2,1-5H3
InChI key:InChIKey=OOMASFPQMMUBTO-UHFFFAOYSA-N
SMILES:C(P(OC)(OC)=O)C#C[Si](C)(C)C
Synonyms:- 3-Dimethoxyphosphorylprop-1-ynyl(trimethyl)silane
- Phosphonic acid, [3-(trimethylsilyl)-2-propynyl]-, dimethyl ester
- Phosphonic acid, [3-(trimethylsilyl)-2-propynyl]-, dimethyl ester (9CI)
- P-2-Propyn-1-yl-phosphonic Acid DiMethyl Ester
- DiMethyl TriMethylsilyl Propargylphosphonate
- DiMethyl Propargylphosphonate.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dimethyl Trimethylsilyl Propargylphosphonate
CAS:Controlled ProductApplications Dimethyl Trimethylsilyl Propargylphosphonate (cas# 228120-29-4) is a compound useful in organic synthesis.
Formula:C8H17O3PSiColor and Shape:NeatMolecular weight:220.28
