CAS 22813-32-7
:(2-nitro-1H-imidazol-1-yl)acetic acid
Description:
(2-Nitro-1H-imidazol-1-yl)acetic acid is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a nitro group at the 2-position of the imidazole ring contributes to its reactivity and potential biological activity. This compound features an acetic acid functional group, which imparts acidic properties and can participate in various chemical reactions, such as esterification or amidation. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and research due to its potential applications in pharmaceuticals, particularly as a building block for drug synthesis or as a bioactive molecule. Safety data should be consulted for handling, as nitro compounds can be sensitive and may pose health risks. Overall, (2-nitro-1H-imidazol-1-yl)acetic acid is a versatile compound with significant implications in chemical and biological research.
Formula:C5H5N3O4
InChI:InChI=1/C5H5N3O4/c9-4(10)3-7-2-1-6-5(7)8(11)12/h1-2H,3H2,(H,9,10)
SMILES:c1cn(CC(=O)O)c(n1)N(=O)=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2-Nitro-1H-imidazol-1-yl)acetic acid
CAS:Formula:C5H5N3O4Purity:97%Color and Shape:SolidMolecular weight:171.11092-(2-Nitro-1H-imidazol-1-yl)acetic acid
CAS:2-(2-Nitro-1H-imidazol-1-yl)acetic acidPurity:97%Molecular weight:171.11g/mol2-(2-Nitro-1H-imidazol-1-yl)acetic acid
CAS:Formula:C5H5N3O4Purity:97%Color and Shape:SolidMolecular weight:171.1122-(2-Nitro-1H-imidazol-1-yl)acetic acid
CAS:2-(2-Nitro-1H-imidazol-1-yl)acetic acid is a potential drug candidate that has been shown to be an inhibitor of DNA gyrase and topoisomerase IV, which are enzymes that maintain the integrity of bacterial DNA. The linker can be attached to the 2-nitroimidazole ring in order to optimize its pharmacological profile. In addition, a nitroimidazole conjugate can be synthesized to provide a diagnostic tool for the detection of bacterial infections.Formula:C5H5N3O4Purity:Min. 95%Molecular weight:171.11 g/mol



