CAS 22816-60-0
:Carbamimidothioic acid, (3,4-dichlorophenyl)methyl ester, hydrochloride (1:1)
Description:
Carbamimidothioic acid, (3,4-dichlorophenyl)methyl ester, hydrochloride (1:1), with the CAS number 22816-60-0, is a chemical compound characterized by its unique functional groups and structural features. It contains a carbamimidothioic acid moiety, which is known for its thiourea-like properties, and a methyl ester derived from a dichlorophenyl group, indicating the presence of chlorine substituents that can influence its reactivity and biological activity. The hydrochloride form suggests that the compound is a salt, enhancing its solubility in polar solvents, which is often advantageous for pharmaceutical applications. This compound may exhibit biological activity due to the presence of the dichlorophenyl group, which is commonly associated with various pharmacological effects. Additionally, the presence of the thiourea functional group may contribute to its potential as a ligand in coordination chemistry or as a precursor in organic synthesis. Overall, the compound's characteristics make it of interest in medicinal chemistry and related fields, although specific applications would depend on further research and characterization.
Formula:C8H8Cl2N2S·ClH
InChI:InChI=1S/C8H8Cl2N2S.ClH/c9-6-2-1-5(3-7(6)10)4-13-8(11)12;/h1-3H,4H2,(H3,11,12);1H
InChI key:InChIKey=VBJNMXMOMSWRDV-UHFFFAOYSA-N
SMILES:C(SC(=N)N)C1=CC(Cl)=C(Cl)C=C1.Cl
Synonyms:- Pseudourea, 2-(3,4-dichlorobenzyl)-2-thio-, hydrochloride
- Carbamimidothioic acid, (3,4-dichlorophenyl)methyl ester, hydrochloride (1:1)
- S-(3,4-Dichlorobenzyl)thiouronium chloride
- Carbamimidothioic acid, (3,4-dichlorophenyl)methyl ester, monohydrochloride
- Pseudourea, 2-(3,4-dichlorobenzyl)-2-thio-, monohydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(3,4-Dichlorobenzyl)isothiourea hydrochloride
CAS:2-(3,4-Dichlorobenzyl)isothiourea hydrochloridePurity:95%Molecular weight:271.59g/mol2-(3,4-Dichloro-benzyl)-isothiourea hydrochloride
CAS:Formula:C8H9Cl3N2SPurity:95.0%Color and Shape:SolidMolecular weight:271.58MreB Perturbing Compound A22
CAS:Controlled ProductApplications MreB Perturbing Compound A22 is an isothiourea that reversibly perturbs MreB function.
Formula:C8H8Cl2N2S•HClColor and Shape:NeatMolecular weight:235.1336462-(3,4-Dichloro-benzyl)-isothiourea hydrochloride
CAS:2-(3,4-Dichloro-benzyl)-isothiourea hydrochloride (2DICH) is a sulfinyl compound that has been shown to be an effective inhibitor of bacterial growth. It binds to the C1-6 alkyl group in the amino acid cysteine and inhibits the synthesis of proteins. 2DICH is bactericidal against organisms such as P. aeruginosa, Staphylococcus aureus and Gram-negative bacteria. The mechanism of action by which 2DICH kills bacteria is not yet known, but it may involve hemolytic activity or interaction with the cell membrane. 2DICH was found to have no effect on stenotrophomonas maltophilia and other Gram-positive bacteria such as Bacillus subtilis or Enterococcus faecalis.Formula:C8H9Cl3N2SPurity:Min. 95%Molecular weight:271.59 g/mol



