CAS 22817-26-1

2,3-Dihydro-1H-benz[de]isoquinoline

Description:

2,3-Dihydro-1H-benz[de]isoquinoline is a bicyclic organic compound that belongs to the class of isoquinolines. It features a fused ring system that includes a benzene ring and a nitrogen-containing heterocycle. This compound is characterized by its molecular structure, which consists of a nitrogen atom incorporated into a polycyclic framework, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound may exhibit various functional properties, including potential biological activity, making it of interest in medicinal chemistry and pharmacology. Its reactivity can be influenced by the presence of the nitrogen atom, which can participate in various chemical reactions, such as electrophilic substitution or nucleophilic attack. Additionally, 2,3-Dihydro-1H-benz[de]isoquinoline may serve as a precursor or intermediate in the synthesis of more complex organic molecules. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₁N

InChI: InChI=1/C12H11N/c1-3-9-4-2-6-11-8-13-7-10(5-1)12(9)11/h1-6,13H,7-8H2

SMILES: c1cc2cccc3CNCc(c1)c23

Synonyms:

• 2,3-dihydro-1H-benzo[de]isoquinoline

2,3-Dihydro-1H-benz[de]isoquinoline, 97%

CAS: 22817-26-1

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₁₂H₁₁N

Purity: 97%

Color and Shape: Crystals or powder or crystalline powder, Green to brown

Molecular weight: 169.23

Ref: 02-L15613

2,3-Dihydro-1H-benzo[de]isoquinoline

CAS: 22817-26-1

Formula: C₁₂H₁₁N

Purity: 97%

Color and Shape: Solid

Molecular weight: 169.2224

Ref: IN-DA003FIS