CAS 22821-70-1

methyl 4-(methylsulfonyl)benzoate

Description:

Methyl 4-(methylsulfonyl)benzoate, with the CAS number 22821-70-1, is an organic compound characterized by its ester functional group and the presence of a methylsulfonyl group. This compound features a benzoate structure, where a methyl group is attached to the sulfur atom of the sulfonyl group, enhancing its solubility in organic solvents. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. Methyl 4-(methylsulfonyl)benzoate is known for its applications in organic synthesis, particularly as an intermediate in the production of pharmaceuticals and agrochemicals. Its chemical properties include moderate stability under standard conditions, though it may be sensitive to strong acids or bases. The compound is generally considered to have low toxicity, but safety precautions should be taken when handling it, as with any chemical substance. Its unique structure allows for various reactivity patterns, making it a valuable compound in synthetic organic chemistry.

Formula: C₉H₁₀O₄S

InChI: InChI=1/C9H10O4S/c1-13-9(10)7-3-5-8(6-4-7)14(2,11)12/h3-6H,1-2H3

SMILES: COC(=O)c1ccc(cc1)S(=O)(=O)C

Synonyms:

• Benzoic acid, 4-(methylsulfonyl)-, methyl ester
• Methyl-4-(methylsulfonyl)benzolcarboxylat
• 4-Methanesulfonylbenzoic acid methyl ester
• Methyl 4-(methylsulfonyl)benzoate

Methyl 4-methanesulfonylbenzoate

CAS: 22821-70-1

Formula: C₉H₁₀O₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 214.2383

Ref: IN-DA003RTX

Methyl 4-(methylsulfonyl)benzoate

CAS: 22821-70-1

Methyl 4-(methylsulfonyl)benzoate

Purity: 97%

Molecular weight: 214.24g/mol

Ref: 54-OR301368

Methyl 4-methanesulfonylbenzoate

CAS: 22821-70-1

Formula: C₉H₁₀O₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 214.24

Ref: 10-F210869