CAS 228246-73-9
:(1R)-1,2-dihydroacenaphthylen-1-amine
Description:
(1R)-1,2-Dihydroacenaphthylen-1-amine is an organic compound characterized by its bicyclic structure, which consists of a fused acenaphthylene framework with an amine functional group. This compound features a chiral center, indicated by the (1R) designation, which implies that it exists in a specific stereoisomeric form. The presence of the amine group suggests that it can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds like this may exhibit interesting properties such as potential biological activity or utility in organic synthesis. The molecular structure contributes to its physical properties, which may include a specific melting point, boiling point, and solubility profile in various solvents. Additionally, due to its unique structure, it may serve as a precursor or intermediate in the synthesis of more complex molecules in medicinal chemistry or materials science. Safety and handling considerations should be taken into account, as with any chemical substance, particularly regarding its potential toxicity or reactivity.
Formula:C12H11N
InChI:InChI=1/C12H11N/c13-11-7-9-5-1-3-8-4-2-6-10(11)12(8)9/h1-6,11H,7,13H2/t11-/m1/s1
SMILES:c1cc2cccc3[C@@H](Cc(c1)c23)N
Synonyms:- 1-Acenaphthylenamine, 1,2-dihydro-, (1R)-
- (1R)-1,2-Dihydroacenaphthylen-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(R)-1,2-Dihydroacenaphthene-1-amine
CAS:Controlled ProductFormula:C12H11NColor and Shape:NeatMolecular weight:169.222

