
CAS 228246-74-0
:(1S)-1,2-Dihydro-1-acenaphthylenamine
Description:
(1S)-1,2-Dihydro-1-acenaphthylenamine is an organic compound characterized by its unique bicyclic structure, which includes an acenaphthylene framework. This compound features a primary amine functional group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The stereochemistry indicated by the "(1S)" designation suggests that it has a specific spatial arrangement of atoms, which can influence its biological activity and interaction with other molecules. Typically, compounds like this may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and the ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its CAS number, 228246-74-0, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, (1S)-1,2-Dihydro-1-acenaphthylenamine represents a valuable compound for further exploration in fields such as pharmaceuticals and materials science.
Formula:C12H11N
InChI:InChI=1S/C12H11N/c13-11-7-9-5-1-3-8-4-2-6-10(11)12(8)9/h1-6,11H,7,13H2/t11-/m0/s1
InChI key:InChIKey=LCYNDXQWJAMEAI-NSHDSACASA-N
SMILES:N[C@@H]1C=2C3=C(C1)C=CC=C3C=CC2
Synonyms:- 1-Acenaphthylenamine, 1,2-dihydro-, (1S)-
- (S)-1,2-Dihydroacenaphthylen-1-amine
- (1S)-1,2-Dihydroacenaphthylen-1-amine
- (1S)-1,2-Dihydro-1-acenaphthylenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
