CAS 228259-44-7
:ethyl 2-(2-cyanophenyl)-2-oxo-acetate
Description:
Ethyl 2-(2-cyanophenyl)-2-oxo-acetate, identified by its CAS number 228259-44-7, is an organic compound characterized by its ester functional group and a cyano-substituted aromatic ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It features a carbonyl group adjacent to an ethyl ester, which contributes to its reactivity and potential applications in organic synthesis. The presence of the cyano group enhances its polarity and may influence its solubility in various organic solvents. Ethyl 2-(2-cyanophenyl)-2-oxo-acetate is often utilized in the synthesis of pharmaceuticals and agrochemicals, owing to its ability to participate in various chemical reactions, such as nucleophilic additions and condensation reactions. Additionally, its structural characteristics may allow for the exploration of its biological activity, making it a compound of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C11H9NO3
InChI:InChI=1/C11H9NO3/c1-2-15-11(14)10(13)9-6-4-3-5-8(9)7-12/h3-6H,2H2,1H3
SMILES:CCOC(=O)C(=O)c1ccccc1C#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
