CAS 22830-45-1: D-Gluconic acid, iron(2+) salt, hydrate (2:1:2)
Description:D-Gluconic acid, iron(2+) salt, hydrate (2:1:2) is a coordination compound formed from D-gluconic acid and iron(II) ions, typically existing as a hydrated salt. This compound is characterized by its ability to chelate iron ions, which enhances the bioavailability of iron in various applications, particularly in nutritional supplements and food fortification. The presence of the D-gluconate ligand contributes to its solubility in water, making it suitable for various formulations. The hydrate form indicates that water molecules are incorporated into its crystalline structure, which can influence its stability and reactivity. This compound is often utilized in the fields of biochemistry and nutrition due to its potential health benefits, including its role in iron supplementation for preventing or treating iron deficiency. Additionally, it may exhibit antioxidant properties, contributing to its functional applications. As with many iron salts, care should be taken regarding dosage and potential interactions with other substances in formulations.
Formula:C6H12O7Fe·H2O
InChI:InChI=1S/C6H12O7.Fe.H2O/c7-1-2(8)3(9)4(10)5(11)6(12)13;;/h2-5,7-11H,1H2,(H,12,13);;1H2/t2-,3-,4+,5-;;/m1../s1
InChI key:InChIKey=WQHWCCNWPQBFKI-ZBHRUSISSA-N
SMILES:[Fe].O=C(O)C(O)C(O)C(O)C(O)CO.O
- Synonyms:
- <span class="text-smallcaps">D</span>-Gluconic acid, iron(2+) salt, dihydrate
- <span class="text-smallcaps">D</span>-Gluconic acid, iron(2+) salt, hydrate (2:1:2)
- Gluconic acid, iron(2+) salt, dihydrate, <span class="text-smallcaps">D</span>-
- Iron(II) gluconate dihydrate
- Gluconic acid, iron(2+) salt, dihydrate, D-
- D-Gluconic acid, iron(2+) salt, dihydrate
- D-Gluconic acid, iron(2+) salt, hydrate (2:1:2)
