CAS 228421-83-8

3,5-difluoro-4-(hydroxymethyl)benzonitrile

Description:

3,5-Difluoro-4-(hydroxymethyl)benzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms and a hydroxymethyl group, as well as a nitrile functional group. The presence of the difluoro substituents indicates that the compound has enhanced reactivity and potential applications in pharmaceuticals and agrochemicals due to the electronegative nature of fluorine, which can influence the compound's biological activity. The hydroxymethyl group contributes to the compound's polarity and solubility in polar solvents, while the nitrile group introduces a triple bond between carbon and nitrogen, which can participate in various chemical reactions, including nucleophilic additions. This compound is likely to exhibit interesting physical properties, such as melting and boiling points, influenced by its molecular structure and substituents. Additionally, its synthesis and reactivity can be of interest in organic chemistry, particularly in the development of new materials or active pharmaceutical ingredients.

Formula: C₈H₅F₂NO

InChI: InChI=1/C8H5F2NO/c9-7-1-5(3-11)2-8(10)6(7)4-12/h1-2,12H,4H2

SMILES: c1c(cc(c(CO)c1F)F)C#N

Synonyms:

• Benzonitrile, 3,5-difluoro-4-(hydroxymethyl)-

3,5-Difluoro-4-(hydroxymethyl)benzonitrile

CAS: 228421-83-8

Formula: C₈H₅F₂NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 169.1282

Ref: IN-DA00BG5A

3,5-Difluoro-4-(hydroxymethyl)benzonitrile

CAS: 228421-83-8

3,5-Difluoro-4-(hydroxymethyl)benzonitrile

Purity: 97%

Color and Shape: Solid

Molecular weight: 169.13g/mol

Ref: 54-PC201204

3,5-Difluoro-4-(hydroxymethyl)benzonitrile

CAS: 228421-83-8

Formula: C₈H₅F₂NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 169.131

Ref: 10-F092898