CymitQuimica logo

CAS 228422-49-9

:

(3S)-3-Amino-3-(4-fluorophenyl)propan-1-ol

Description:
(3S)-3-Amino-3-(4-fluorophenyl)propan-1-ol, with the CAS number 228422-49-9, is an organic compound characterized by its amino alcohol structure. It features a chiral center at the carbon atom adjacent to the amino group, which contributes to its stereochemistry, specifically the S configuration. The presence of a 4-fluorophenyl group indicates that the compound has a fluorine atom substituted on a phenyl ring, which can influence its biological activity and physical properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the hydroxyl and amino functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as amino alcohols often serve as intermediates or active pharmaceutical ingredients. The compound's properties, such as melting point, boiling point, and reactivity, can vary based on its specific interactions with other molecules and its environment. Overall, (3S)-3-Amino-3-(4-fluorophenyl)propan-1-ol is of interest for its potential therapeutic applications and its role in chemical synthesis.
Formula:C9H12FNO
InChI:InChI=1/C9H12FNO/c10-8-3-1-7(2-4-8)9(11)5-6-12/h1-4,9,12H,5-6,11H2/t9-/m0/s1
InChI key:CCJPLYPJQZYBLI-VIFPVBQESA-N
SMILES:c1cc(ccc1[C@H](CCO)N)F
Synonyms:
  • benzenepropanol, gamma-amino-4-fluoro-, (gammaS)-
Found 4 products.