CAS 22850-13-1
:Geranyl glucoside
Description:
Geranyl glucoside is a glycoside compound characterized by the presence of a geranyl group linked to a glucose molecule. It is typically found in various plants and is known for its potential biological activities, including antioxidant and antimicrobial properties. The compound is often studied for its role in plant defense mechanisms and its contribution to the flavor and aroma profiles of certain fruits and herbs. Geranyl glucoside is soluble in water due to the hydrophilic nature of the glucose moiety, while the geranyl part contributes to its lipophilicity. This dual solubility can influence its behavior in biological systems and its applications in food and cosmetic industries. Additionally, geranyl glucoside may undergo hydrolysis to release geraniol, a compound with notable fragrance and therapeutic properties. Its stability and reactivity can be affected by environmental factors such as pH and temperature, making it an interesting subject for further research in natural product chemistry and pharmacology.
Formula:C16H28O6
InChI:InChI=1S/C16H28O6/c1-10(2)5-4-6-11(3)7-8-21-16-15(20)14(19)13(18)12(9-17)22-16/h5,7,12-20H,4,6,8-9H2,1-3H3/b11-7+/t12-,13-,14+,15-,16-/m1/s1
InChI key:InChIKey=RMMXLHZEVYNSJO-QYSJADTOSA-N
SMILES:O(C/C=C(/CCC=C(C)C)\C)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Synonyms:- β-D-Glucopyranoside, (2E)-3,7-dimethyl-2,6-octadienyl
- (2E)-3,7-Dimethyl-2,6-octadien-1-yl β-D-glucopyranoside
- β-D-Glucopyranoside, (2E)-3,7-dimethyl-2,6-octadien-1-yl
- β-D-Glucopyranoside, 3,7-dimethyl-2,6-octadienyl, (E)-
- Glucopyranoside, 3,7-dimethyl-2,6-octadienyl, (E)-β-D-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Geranyl β-D-glucopyranoside
CAS:Geranyl β-D-glucopyranosidePurity:95%Color and Shape:SolidMolecular weight:316.38992g/molGeranyl b-D-glucoside
CAS:Geranyl b-D-glucoside is a supramolecular amphiphile that can be used as a biofuel. It is made up of two molecules: geranyl and glucose. Geranyl b-D-glucoside has been shown to form micelles in water with the help of ions, which are complex aggregates of many molecules that have a hydrophobic interior and hydrophilic exterior. The micelles are able to stabilize the fuel and protect it from degradation by sunlight or other environmental factors. The thermodynamics of the system can be quantified through the parameters of this supramolecular amphiphile, which will allow for predictive modelling.
Formula:C16H28O6Purity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:316.39 g/mol


