CAS 22855-95-4

4-(benzylsulfanyl)benzoic acid

Description:

4-(Benzylsulfanyl)benzoic acid, identified by its CAS number 22855-95-4, is an organic compound characterized by the presence of both a benzoic acid moiety and a benzylthio group. This compound features a benzene ring substituted with a sulfanyl (thioether) group attached to another benzene ring, which contributes to its unique chemical properties. The presence of the carboxylic acid functional group (-COOH) makes it acidic and allows for potential hydrogen bonding, influencing its solubility and reactivity. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its structure suggests potential applications in organic synthesis, pharmaceuticals, and materials science, particularly in the development of novel compounds with specific biological activities or as intermediates in chemical reactions. Additionally, the presence of sulfur in the structure may impart unique electronic properties, making it of interest in various chemical research fields.

Formula: C₁₄H₁₂O₂S

InChI: InChI=1/C14H12O2S/c15-14(16)12-6-8-13(9-7-12)17-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,15,16)

SMILES: c1ccc(cc1)CSc1ccc(cc1)C(=O)O

Benzoic acid, 4-[(phenylmethyl)thio]-

CAS: 22855-95-4

Formula: C₁₄H₁₂O₂S

Purity: 95%

Molecular weight: 244.3089

Ref: IN-DA00I4HX

4-(Benzylsulfanyl)benzoic acid

CAS: 22855-95-4

Purity: ≥95%

Molecular weight: 244.3099976

Ref: 10-F636021